C9H13ClN2O4S — CID 171862655
ethyl 2-amino-5-(3-chloro-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate (PubChem CID 171862655) has the molecular formula C9H13ClN2O4S and a molecular weight of 280.73 g/mol. Its IUPAC name is ethyl 2-amino-5-(3-chloro-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-(3-chloro-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 171862655 |
| Molecular Formula | C9H13ClN2O4S |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl 2-amino-5-(3-chloro-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1C(O)C(O)CCl |
| InChI | InChI=1S/C9H13ClN2O4S/c1-2-16-8(15)5-7(17-9(11)12-5)6(14)4(13)3-10/h4,6,13-14H,2-3H2,1H3,(H2,11,12) |
| InChIKey | TYAQFSOLTDAMPO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|