C9H13N5O4S — CID 170826643
ethyl 2-amino-5-(3-azido-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate (PubChem CID 170826643) has the molecular formula C9H13N5O4S and a molecular weight of 287.30 g/mol. Its IUPAC name is ethyl 2-amino-5-(3-azido-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-(3-azido-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170826643 |
| Molecular Formula | C9H13N5O4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | ethyl 2-amino-5-(3-azido-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1C(O)C(O)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H13N5O4S/c1-2-18-8(17)5-7(19-9(10)13-5)6(16)4(15)3-12-14-11/h4,6,15-16H,2-3H2,1H3,(H2,10,13) |
| InChIKey | CBABURJSTMCYIY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|