C8H8N2O2S — CID 86609812
ethyl 2-amino-5-ethynyl-1,3-thiazole-4-carboxylate (PubChem CID 86609812) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is ethyl 2-amino-5-ethynyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-ethynyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 86609812 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | ethyl 2-amino-5-ethynyl-1,3-thiazole-4-carboxylate |
| SMILES | C#Cc1sc(N)nc1C(=O)OCC |
| InChI | InChI=1S/C8H8N2O2S/c1-3-5-6(7(11)12-4-2)10-8(9)13-5/h1H,4H2,2H3,(H2,9,10) |
| InChIKey | YODTYONCXSASLL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|