C9H13ClN2O2S — CID 59418686
ethyl 2-amino-5-(3-chloropropyl)-1,3-thiazole-4-carboxylate (PubChem CID 59418686) has the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. Its IUPAC name is ethyl 2-amino-5-(3-chloropropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-(3-chloropropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59418686 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | ethyl 2-amino-5-(3-chloropropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1CCCCl |
| InChI | InChI=1S/C9H13ClN2O2S/c1-2-14-8(13)7-6(4-3-5-10)15-9(11)12-7/h2-5H2,1H3,(H2,11,12) |
| InChIKey | SFRFJVLFBBWTOC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|