C15H16BrFN2O3S — CID 155593141
ethyl 2-amino-5-[3-(4-bromo-2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate (PubChem CID 155593141) has the molecular formula C15H16BrFN2O3S and a molecular weight of 403.27 g/mol. Its IUPAC name is ethyl 2-amino-5-[3-(4-bromo-2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-amino-5-[3-(4-bromo-2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155593141 |
| Molecular Formula | C15H16BrFN2O3S |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | ethyl 2-amino-5-[3-(4-bromo-2-fluorophenoxy)propyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1CCCOc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H16BrFN2O3S/c1-2-21-14(20)13-12(23-15(18)19-13)4-3-7-22-11-6-5-9(16)8-10(11)17/h5-6,8H,2-4,7H2,1H3,(H2,18,19) |
| InChIKey | TTWRAAHJUIELBK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|