C14H12ClFINO3S — CID 167519876
methyl 2-chloro-5-[3-(2-fluoro-4-iodophenoxy)propyl]-1,3-thiazole-4-carboxylate (PubChem CID 167519876) has the molecular formula C14H12ClFINO3S and a molecular weight of 455.68 g/mol. Its IUPAC name is methyl 2-chloro-5-[3-(2-fluoro-4-iodophenoxy)propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-chloro-5-[3-(2-fluoro-4-iodophenoxy)propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 167519876 |
| Molecular Formula | C14H12ClFINO3S |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | methyl 2-chloro-5-[3-(2-fluoro-4-iodophenoxy)propyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(Cl)sc1CCCOc1ccc(I)cc1F |
| InChI | InChI=1S/C14H12ClFINO3S/c1-20-13(19)12-11(22-14(15)18-12)3-2-6-21-10-5-4-8(17)7-9(10)16/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | PRUBGXOEMYBEKH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|