C15H17ClFNO2S — CID 167489516
2-chloro-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-5-propyl-1,3-thiazole (PubChem CID 167489516) has the molecular formula C15H17ClFNO2S and a molecular weight of 329.82 g/mol. Its IUPAC name is 2-chloro-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-5-propyl-1,3-thiazole.
| Compound Name | 2-chloro-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-5-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 167489516 |
| Molecular Formula | C15H17ClFNO2S |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-chloro-4-[3-fluoro-4-(2-methoxyethoxy)phenyl]-5-propyl-1,3-thiazole |
| SMILES | CCCc1sc(Cl)nc1-c1ccc(OCCOC)c(F)c1 |
| InChI | InChI=1S/C15H17ClFNO2S/c1-3-4-13-14(18-15(16)21-13)10-5-6-12(11(17)9-10)20-8-7-19-2/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | XGOLUBBVLIWRTJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|