C16H19ClFNO2S — CID 167489213
2-chloro-4-[4-fluoro-3-(2-methoxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole (PubChem CID 167489213) has the molecular formula C16H19ClFNO2S and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-chloro-4-[4-fluoro-3-(2-methoxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 2-chloro-4-[4-fluoro-3-(2-methoxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 167489213 |
| Molecular Formula | C16H19ClFNO2S |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-chloro-4-[4-fluoro-3-(2-methoxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
| SMILES | COCCOc1cc(-c2nc(Cl)sc2CC(C)C)ccc1F |
| InChI | InChI=1S/C16H19ClFNO2S/c1-10(2)8-14-15(19-16(17)22-14)11-4-5-12(18)13(9-11)21-7-6-20-3/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | PAWRIOSQVJVWAO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|