C18H23ClFNO2S — CID 167489206
2-chloro-4-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole (PubChem CID 167489206) has the molecular formula C18H23ClFNO2S and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-chloro-4-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 2-chloro-4-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 167489206 |
| Molecular Formula | C18H23ClFNO2S |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-chloro-4-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
| SMILES | CC(C)Cc1sc(Cl)nc1-c1ccc(F)c(OCCOC(C)C)c1 |
| InChI | InChI=1S/C18H23ClFNO2S/c1-11(2)9-16-17(21-18(19)24-16)13-5-6-14(20)15(10-13)23-8-7-22-12(3)4/h5-6,10-12H,7-9H2,1-4H3 |
| InChIKey | MCIRYSVEXHBROB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|