C11H14BF4O2- — CID 114675006
trifluoro-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]boranuide (PubChem CID 114675006) has the molecular formula C11H14BF4O2- and a molecular weight of 265.03 g/mol. Its IUPAC name is trifluoro-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]boranuide.
| Compound Name | trifluoro-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 114675006 |
| Molecular Formula | C11H14BF4O2- |
| Molecular Weight | 265.03 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | trifluoro-[4-fluoro-3-(2-propan-2-yloxyethoxy)phenyl]boranuide |
| SMILES | CC(C)OCCOc1cc([B-](F)(F)F)ccc1F |
| InChI | InChI=1S/C11H14BF4O2/c1-8(2)17-5-6-18-11-7-9(12(14,15)16)3-4-10(11)13/h3-4,7-8H,5-6H2,1-2H3/q-1 |
| InChIKey | ZBFGODLZVSDBSU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.03 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|