C11H12BF4KO — CID 114675089
potassium [3-(2-cyclopropylethoxy)-4-fluorophenyl]-trifluoroboranuide (PubChem CID 114675089) has the molecular formula C11H12BF4KO and a molecular weight of 286.12 g/mol. Its IUPAC name is potassium [3-(2-cyclopropylethoxy)-4-fluorophenyl]-trifluoroboranuide.
| Compound Name | potassium [3-(2-cyclopropylethoxy)-4-fluorophenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 114675089 |
| Molecular Formula | C11H12BF4KO |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | potassium [3-(2-cyclopropylethoxy)-4-fluorophenyl]-trifluoroboranuide |
| SMILES | Fc1ccc([B-](F)(F)F)cc1OCCC1CC1.[K+] |
| InChI | InChI=1S/C11H12BF4O.K/c13-10-4-3-9(12(14,15)16)7-11(10)17-6-5-8-1-2-8;/h3-4,7-8H,1-2,5-6H2;/q-1;+1 |
| InChIKey | CXXBCUJBNWBKDD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|