C19H27ClN2O2S — CID 167489558
2-[2-[3-[2-chloro-5-(2-methylpropyl)-1,3-thiazol-4-yl]phenoxy]ethoxy]-N,N-dimethylethanamine (PubChem CID 167489558) has the molecular formula C19H27ClN2O2S and a molecular weight of 382.96 g/mol. Its IUPAC name is 2-[2-[3-[2-chloro-5-(2-methylpropyl)-1,3-thiazol-4-yl]phenoxy]ethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[3-[2-chloro-5-(2-methylpropyl)-1,3-thiazol-4-yl]phenoxy]ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 167489558 |
| Molecular Formula | C19H27ClN2O2S |
| Molecular Weight | 382.96 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[2-[3-[2-chloro-5-(2-methylpropyl)-1,3-thiazol-4-yl]phenoxy]ethoxy]-N,N-dimethylethanamine |
| SMILES | CC(C)Cc1sc(Cl)nc1-c1cccc(OCCOCCN(C)C)c1 |
| InChI | InChI=1S/C19H27ClN2O2S/c1-14(2)12-17-18(21-19(20)25-17)15-6-5-7-16(13-15)24-11-10-23-9-8-22(3)4/h5-7,13-14H,8-12H2,1-4H3 |
| InChIKey | HLOQXTPVLZBRIN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|