C13H18N2O2 — CID 156795758
N,N-dimethyl-2-[3-(2-methyloxazet-4-yl)phenoxy]ethanamine (PubChem CID 156795758) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(2-methyloxazet-4-yl)phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[3-(2-methyloxazet-4-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 156795758 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N,N-dimethyl-2-[3-(2-methyloxazet-4-yl)phenoxy]ethanamine |
| SMILES | CN(C)CCOc1cccc(-c2cn(C)o2)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-14(2)7-8-16-12-6-4-5-11(9-12)13-10-15(3)17-13/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | QHYKXUCSZHKEON-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |