C12H11Cl2NOS — CID 174418105
2-chloro-4-(4-chlorophenyl)-5-propoxy-1,3-thiazole (PubChem CID 174418105) has the molecular formula C12H11Cl2NOS and a molecular weight of 288.20 g/mol. Its IUPAC name is 2-chloro-4-(4-chlorophenyl)-5-propoxy-1,3-thiazole.
| Compound Name | 2-chloro-4-(4-chlorophenyl)-5-propoxy-1,3-thiazole |
|---|---|
| PubChem CID | 174418105 |
| Molecular Formula | C12H11Cl2NOS |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2-chloro-4-(4-chlorophenyl)-5-propoxy-1,3-thiazole |
| SMILES | CCCOc1sc(Cl)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11Cl2NOS/c1-2-7-16-11-10(15-12(14)17-11)8-3-5-9(13)6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | HMXXVKRHUNTVSZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |