C23H21ClN2OS2 — CID 46339240
2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4-(4-chlorophenyl)-5-methyl-1,3-thiazole (PubChem CID 46339240) has the molecular formula C23H21ClN2OS2 and a molecular weight of 441.02 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4-(4-chlorophenyl)-5-methyl-1,3-thiazole.
| Compound Name | 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4-(4-chlorophenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 46339240 |
| Molecular Formula | C23H21ClN2OS2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-4-(4-chlorophenyl)-5-methyl-1,3-thiazole |
| SMILES | CCCCOc1ccc(-c2csc(-c3nc(-c4ccc(Cl)cc4)c(C)s3)n2)cc1 |
| InChI | InChI=1S/C23H21ClN2OS2/c1-3-4-13-27-19-11-7-16(8-12-19)20-14-28-22(25-20)23-26-21(15(2)29-23)17-5-9-18(24)10-6-17/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | HLHPSLIZRYLVNC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|