C12H9BrClNO2S — CID 39732279
ethyl 2-bromo-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylate (PubChem CID 39732279) has the molecular formula C12H9BrClNO2S and a molecular weight of 346.63 g/mol. Its IUPAC name is ethyl 2-bromo-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-bromo-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 39732279 |
| Molecular Formula | C12H9BrClNO2S |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | ethyl 2-bromo-4-(4-chlorophenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Br)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9BrClNO2S/c1-2-17-11(16)10-9(15-12(13)18-10)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | WZCJTQKTWNBMCU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |