C20H16Cl2N2O3 — CID 69142158
ethyl 5,6-bis(4-chlorophenyl)-3-(hydroxymethyl)pyrazine-2-carboxylate (PubChem CID 69142158) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is ethyl 5,6-bis(4-chlorophenyl)-3-(hydroxymethyl)pyrazine-2-carboxylate.
| Compound Name | ethyl 5,6-bis(4-chlorophenyl)-3-(hydroxymethyl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 69142158 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | ethyl 5,6-bis(4-chlorophenyl)-3-(hydroxymethyl)pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1CO |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-2-27-20(26)19-16(11-25)23-17(12-3-7-14(21)8-4-12)18(24-19)13-5-9-15(22)10-6-13/h3-10,25H,2,11H2,1H3 |
| InChIKey | GXGAVNOWMWNJND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |