C13H10ClF3N2O2 — CID 123663096
ethyl 2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-imidazole-4-carboxylate (PubChem CID 123663096) has the molecular formula C13H10ClF3N2O2 and a molecular weight of 318.68 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-imidazole-4-carboxylate.
| Compound Name | ethyl 2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 123663096 |
| Molecular Formula | C13H10ClF3N2O2 |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-5-(trifluoromethyl)-1H-imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(Cl)cc2)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N2O2/c1-2-21-12(20)9-10(13(15,16)17)19-11(18-9)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3,(H,18,19) |
| InChIKey | PORQFZQVEKWMKP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |