C12H10Cl2N2O2S — CID 34173292
ethyl 2-amino-4-(3,5-dichlorophenyl)-1,3-thiazole-5-carboxylate (PubChem CID 34173292) has the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.20 g/mol. Its IUPAC name is ethyl 2-amino-4-(3,5-dichlorophenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-amino-4-(3,5-dichlorophenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 34173292 |
| Molecular Formula | C12H10Cl2N2O2S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | ethyl 2-amino-4-(3,5-dichlorophenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N)nc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O2S/c1-2-18-11(17)10-9(16-12(15)19-10)6-3-7(13)5-8(14)4-6/h3-5H,2H2,1H3,(H2,15,16) |
| InChIKey | PDNQPIMWWJXBAA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |