C17H19ClF3NO2S — CID 167489101
2-chloro-4-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-(2-methylpropyl)-1,3-thiazole (PubChem CID 167489101) has the molecular formula C17H19ClF3NO2S and a molecular weight of 393.86 g/mol. Its IUPAC name is 2-chloro-4-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 2-chloro-4-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 167489101 |
| Molecular Formula | C17H19ClF3NO2S |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-chloro-4-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-(2-methylpropyl)-1,3-thiazole |
| SMILES | COCCOc1ccc(-c2nc(Cl)sc2CC(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C17H19ClF3NO2S/c1-10(2)8-14-15(22-16(18)25-14)11-4-5-13(24-7-6-23-3)12(9-11)17(19,20)21/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | VAIYUIQCRNDLPT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|