C14H15F3N2O4 — CID 154663829
(6S)-5-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-6-methyl-3,6-dihydro-1,3,4-oxadiazin-2-one (PubChem CID 154663829) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is (6S)-5-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-6-methyl-3,6-dihydro-1,3,4-oxadiazin-2-one.
| Compound Name | (6S)-5-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-6-methyl-3,6-dihydro-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 154663829 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (6S)-5-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-6-methyl-3,6-dihydro-1,3,4-oxadiazin-2-one |
| SMILES | COCCOc1ccc(C2=NNC(=O)O[C@H]2C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O4/c1-8-12(18-19-13(20)23-8)9-3-4-11(22-6-5-21-2)10(7-9)14(15,16)17/h3-4,7-8H,5-6H2,1-2H3,(H,19,20)/t8-/m0/s1 |
| InChIKey | UIMKYZIKONFYKI-QMMMGPOBSA-N |
| XLogP | 2.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|