C33H40FN3O6S — CID 175572804
methyl 2-[2-(2,2-dimethyl-1,3-dioxan-4-yl)ethylamino]-5-[3-[2-fluoro-4-[3-(4-methoxy-N-methylanilino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylate (PubChem CID 175572804) has the molecular formula C33H40FN3O6S and a molecular weight of 625.76 g/mol. Its IUPAC name is methyl 2-[2-(2,2-dimethyl-1,3-dioxan-4-yl)ethylamino]-5-[3-[2-fluoro-4-[3-(4-methoxy-N-methylanilino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-(2,2-dimethyl-1,3-dioxan-4-yl)ethylamino]-5-[3-[2-fluoro-4-[3-(4-methoxy-N-methylanilino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 175572804 |
| Molecular Formula | C33H40FN3O6S |
| Molecular Weight | 625.76 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | methyl 2-[2-(2,2-dimethyl-1,3-dioxan-4-yl)ethylamino]-5-[3-[2-fluoro-4-[3-(4-methoxy-N-methylanilino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NCCC2CCOC(C)(C)O2)sc1CCCOc1ccc(C#CCN(C)c2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C33H40FN3O6S/c1-33(2)42-21-17-26(43-33)16-18-35-32-36-30(31(38)40-5)29(44-32)9-7-20-41-28-15-10-23(22-27(28)34)8-6-19-37(3)24-11-13-25(39-4)14-12-24/h10-15,22,26H,7,9,16-21H2,1-5H3,(H,35,36) |
| InChIKey | LBBFJTXAAIQYTC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|