C32H38FN3O7S2 — CID 172635268
methyl 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-5-[3-[4-[3-[(2,3-dimethylphenyl)sulfonylamino]prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate (PubChem CID 172635268) has the molecular formula C32H38FN3O7S2 and a molecular weight of 659.80 g/mol. Its IUPAC name is methyl 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-5-[3-[4-[3-[(2,3-dimethylphenyl)sulfonylamino]prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-5-[3-[4-[3-[(2,3-dimethylphenyl)sulfonylamino]prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 172635268 |
| Molecular Formula | C32H38FN3O7S2 |
| Molecular Weight | 659.80 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | methyl 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethylamino]-5-[3-[4-[3-[(2,3-dimethylphenyl)sulfonylamino]prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NCCC2COC(C)(C)O2)sc1CCCOc1ccc(C#CCNS(=O)(=O)c2cccc(C)c2C)cc1F |
| InChI | InChI=1S/C32H38FN3O7S2/c1-21-9-6-12-28(22(21)2)45(38,39)35-16-7-10-23-13-14-26(25(33)19-23)41-18-8-11-27-29(30(37)40-5)36-31(44-27)34-17-15-24-20-42-32(3,4)43-24/h6,9,12-14,19,24,35H,8,11,15-18,20H2,1-5H3,(H,34,36) |
| InChIKey | SOFKLWXEQVXPPO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.80 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|