C23H28FN3O5S — CID 175967566
2-(butoxycarbonylamino)-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 175967566) has the molecular formula C23H28FN3O5S and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(butoxycarbonylamino)-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175967566 |
| Molecular Formula | C23H28FN3O5S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-(butoxycarbonylamino)-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCOC(=O)Nc1nc(C(=O)O)c(CCCOc2ccc(C#CCN(C)C)cc2F)s1 |
| InChI | InChI=1S/C23H28FN3O5S/c1-4-5-13-32-23(30)26-22-25-20(21(28)29)19(33-22)9-7-14-31-18-11-10-16(15-17(18)24)8-6-12-27(2)3/h10-11,15H,4-5,7,9,12-14H2,1-3H3,(H,28,29)(H,25,26,30) |
| InChIKey | ITSWXRHCTAUISS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|