C31H46FN3O6SSi — CID 175572781
2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[2-fluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 175572781) has the molecular formula C31H46FN3O6SSi and a molecular weight of 635.88 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[2-fluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[2-fluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175572781 |
| Molecular Formula | C31H46FN3O6SSi |
| Molecular Weight | 635.88 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[2-fluoro-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1ccc(OCCCc2sc(NCCCCO[Si](C)(C)C(C)(C)C)nc2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C31H46FN3O6SSi/c1-30(2,3)41-29(38)34-18-11-13-22-15-16-24(23(32)21-22)39-19-12-14-25-26(27(36)37)35-28(42-25)33-17-9-10-20-40-43(7,8)31(4,5)6/h15-16,21H,9-10,12,14,17-20H2,1-8H3,(H,33,35)(H,34,38)(H,36,37) |
| InChIKey | HJTICUAIGLKZCF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.88 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|