C21H30FNO3 — CID 91336296
tert-butyl 6-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]hexanoate (PubChem CID 91336296) has the molecular formula C21H30FNO3 and a molecular weight of 363.47 g/mol. Its IUPAC name is tert-butyl 6-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]hexanoate.
| Compound Name | tert-butyl 6-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]hexanoate |
|---|---|
| PubChem CID | 91336296 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl 6-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]hexanoate |
| SMILES | CN(C)CC#Cc1ccc(OCCCCCC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C21H30FNO3/c1-21(2,3)26-20(24)11-7-6-8-15-25-19-13-12-17(16-18(19)22)10-9-14-23(4)5/h12-13,16H,6-8,11,14-15H2,1-5H3 |
| InChIKey | IFCOHVLCAVRYCN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|