C23H36FNO3Si — CID 175729452
tert-butyl N-[3-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]prop-2-ynyl]carbamate (PubChem CID 175729452) has the molecular formula C23H36FNO3Si and a molecular weight of 421.63 g/mol. Its IUPAC name is tert-butyl N-[3-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 175729452 |
| Molecular Formula | C23H36FNO3Si |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl N-[3-[3-fluoro-4-tri(propan-2-yl)silyloxyphenyl]prop-2-ynyl]carbamate |
| SMILES | CC(C)[Si](Oc1ccc(C#CCNC(=O)OC(C)(C)C)cc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36FNO3Si/c1-16(2)29(17(3)4,18(5)6)28-21-13-12-19(15-20(21)24)11-10-14-25-22(26)27-23(7,8)9/h12-13,15-18H,14H2,1-9H3,(H,25,26) |
| InChIKey | DYECZXVYVCSWBJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|