C22H27FN2O5 — CID 140525838
ethyl (Z)-3-(dimethylamino)-2-[2-fluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoyl]prop-2-enoate (PubChem CID 140525838) has the molecular formula C22H27FN2O5 and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl (Z)-3-(dimethylamino)-2-[2-fluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(dimethylamino)-2-[2-fluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoyl]prop-2-enoate |
|---|---|
| PubChem CID | 140525838 |
| Molecular Formula | C22H27FN2O5 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl (Z)-3-(dimethylamino)-2-[2-fluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)c1cc(C#CCNC(=O)OC(C)(C)C)ccc1F |
| InChI | InChI=1S/C22H27FN2O5/c1-7-29-20(27)17(14-25(5)6)19(26)16-13-15(10-11-18(16)23)9-8-12-24-21(28)30-22(2,3)4/h10-11,13-14H,7,12H2,1-6H3,(H,24,28)/b17-14- |
| InChIKey | NMFQJOXSOKUXLO-VKAVYKQESA-N |
| XLogP | 2.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|