C11H11ClFN — CID 130055918
3-(4-chloro-3-fluorophenyl)-N,N-dimethylprop-2-yn-1-amine (PubChem CID 130055918) has the molecular formula C11H11ClFN and a molecular weight of 211.67 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N,N-dimethylprop-2-yn-1-amine.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N,N-dimethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 130055918 |
| Molecular Formula | C11H11ClFN |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N,N-dimethylprop-2-yn-1-amine |
| SMILES | CN(C)CC#Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H11ClFN/c1-14(2)7-3-4-9-5-6-10(12)11(13)8-9/h5-6,8H,7H2,1-2H3 |
| InChIKey | LCTFAWNEZNIHLT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|