C22H22N2O2S — CID 11559908
3-[7-[3-(dimethylamino)prop-1-ynyl]-5,5-dioxodibenzothiophen-3-yl]-N,N-dimethylprop-2-yn-1-amine (PubChem CID 11559908) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-[7-[3-(dimethylamino)prop-1-ynyl]-5,5-dioxodibenzothiophen-3-yl]-N,N-dimethylprop-2-yn-1-amine.
| Compound Name | 3-[7-[3-(dimethylamino)prop-1-ynyl]-5,5-dioxodibenzothiophen-3-yl]-N,N-dimethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 11559908 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[7-[3-(dimethylamino)prop-1-ynyl]-5,5-dioxodibenzothiophen-3-yl]-N,N-dimethylprop-2-yn-1-amine |
| SMILES | CN(C)CC#Cc1ccc2c(c1)S(=O)(=O)c1cc(C#CCN(C)C)ccc1-2 |
| InChI | InChI=1S/C22H22N2O2S/c1-23(2)13-5-7-17-9-11-19-20-12-10-18(8-6-14-24(3)4)16-22(20)27(25,26)21(19)15-17/h9-12,15-16H,13-14H2,1-4H3 |
| InChIKey | GDRBKJSKNJPNNK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|