C11H10F3N — CID 146003781
N,N-dimethyl-3-(3,4,5-trifluorophenyl)prop-2-yn-1-amine (PubChem CID 146003781) has the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. Its IUPAC name is N,N-dimethyl-3-(3,4,5-trifluorophenyl)prop-2-yn-1-amine.
| Compound Name | N,N-dimethyl-3-(3,4,5-trifluorophenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 146003781 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N,N-dimethyl-3-(3,4,5-trifluorophenyl)prop-2-yn-1-amine |
| SMILES | CN(C)CC#Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H10F3N/c1-15(2)5-3-4-8-6-9(12)11(14)10(13)7-8/h6-7H,5H2,1-2H3 |
| InChIKey | DXMKCWFYGKPXBE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|