C10H7ClF2O — CID 170467694
5-(4-chlorobut-1-ynyl)-2,3-difluorophenol (PubChem CID 170467694) has the molecular formula C10H7ClF2O and a molecular weight of 216.61 g/mol. Its IUPAC name is 5-(4-chlorobut-1-ynyl)-2,3-difluorophenol.
| Compound Name | 5-(4-chlorobut-1-ynyl)-2,3-difluorophenol |
|---|---|
| PubChem CID | 170467694 |
| Molecular Formula | C10H7ClF2O |
| Molecular Weight | 216.61 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 5-(4-chlorobut-1-ynyl)-2,3-difluorophenol |
| SMILES | Oc1cc(C#CCCCl)cc(F)c1F |
| InChI | InChI=1S/C10H7ClF2O/c11-4-2-1-3-7-5-8(12)10(13)9(14)6-7/h5-6,14H,2,4H2 |
| InChIKey | ZNXZDYBPMGQJNV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|