C11H8ClF3 — CID 130055839
5-(5-chloropent-1-ynyl)-1,2,3-trifluorobenzene (PubChem CID 130055839) has the molecular formula C11H8ClF3 and a molecular weight of 232.63 g/mol. Its IUPAC name is 5-(5-chloropent-1-ynyl)-1,2,3-trifluorobenzene.
| Compound Name | 5-(5-chloropent-1-ynyl)-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 130055839 |
| Molecular Formula | C11H8ClF3 |
| Molecular Weight | 232.63 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 5-(5-chloropent-1-ynyl)-1,2,3-trifluorobenzene |
| SMILES | Fc1cc(C#CCCCCl)cc(F)c1F |
| InChI | InChI=1S/C11H8ClF3/c12-5-3-1-2-4-8-6-9(13)11(15)10(14)7-8/h6-7H,1,3,5H2 |
| InChIKey | BHJUGVBSZUAAEL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|