C11H9Cl3 — CID 112554296
1,2-dichloro-4-(5-chloropent-1-ynyl)benzene (PubChem CID 112554296) has the molecular formula C11H9Cl3 and a molecular weight of 247.55 g/mol. Its IUPAC name is 1,2-dichloro-4-(5-chloropent-1-ynyl)benzene.
| Compound Name | 1,2-dichloro-4-(5-chloropent-1-ynyl)benzene |
|---|---|
| PubChem CID | 112554296 |
| Molecular Formula | C11H9Cl3 |
| Molecular Weight | 247.55 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 1,2-dichloro-4-(5-chloropent-1-ynyl)benzene |
| SMILES | ClCCCC#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl3/c12-7-3-1-2-4-9-5-6-10(13)11(14)8-9/h5-6,8H,1,3,7H2 |
| InChIKey | KHHZFTPKTQPDIH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|