C11H11Cl2N — CID 170463870
4-(3,4-dichlorophenyl)-N-methylbut-3-yn-1-amine (PubChem CID 170463870) has the molecular formula C11H11Cl2N and a molecular weight of 228.12 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-methylbut-3-yn-1-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170463870 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N/c1-14-7-3-2-4-9-5-6-10(12)11(13)8-9/h5-6,8,14H,3,7H2,1H3 |
| InChIKey | CTHQTNWPCVUPJB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|