C10H10F2N2 — CID 170465388
4-(2,6-difluoro-4-pyridinyl)-N-methylbut-3-yn-1-amine (PubChem CID 170465388) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-pyridinyl)-N-methylbut-3-yn-1-amine.
| Compound Name | 4-(2,6-difluoro-4-pyridinyl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170465388 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-(2,6-difluoro-4-pyridinyl)-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1cc(F)nc(F)c1 |
| InChI | InChI=1S/C10H10F2N2/c1-13-5-3-2-4-8-6-9(11)14-10(12)7-8/h6-7,13H,3,5H2,1H3 |
| InChIKey | GSMCNGSENAOCOL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|