2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid

C12H11F2NO2 — CID 170464861

IUPAC2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid
SMILESCNCCC#Cc1cc(F)c(C(=O)O)c(F)c1
InChIInChI=1S/C12H11F2NO2/c1-15-5-3-2-4-8-6-9(13)11(12(16)17)10(14)7-8/h6-7,15H,3,5H2,1H3,(H,16,17)
InChIKeyFUQPTPIXOUVWTG-UHFFFAOYSA-N
MW239.22 g/mol
LogP1.62
Rot. Bonds3

About 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid

2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid (PubChem CID 170464861) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid.

Molecular Properties

Compound Name2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid
PubChem CID170464861
Molecular FormulaC12H11F2NO2
Molecular Weight239.22 g/mol
Exact Mass239.08
IUPAC Name2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid
SMILESCNCCC#Cc1cc(F)c(C(=O)O)c(F)c1
InChIInChI=1S/C12H11F2NO2/c1-15-5-3-2-4-8-6-9(13)11(12(16)17)10(14)7-8/h6-7,15H,3,5H2,1H3,(H,16,17)
InChIKeyFUQPTPIXOUVWTG-UHFFFAOYSA-N
XLogP1.62
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.22
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid?
The IUPAC name of 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid (CID 170464861) is 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid.
What is the SMILES notation for 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid?
The canonical SMILES for 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid is CNCCC#Cc1cc(F)c(C(=O)O)c(F)c1.
What is the InChIKey of 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid?
The InChIKey is FUQPTPIXOUVWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2NO2/c1-15-5-3-2-4-8-6-9(13)11(12(16)17)10(14)7-8/h6-7,15H,3,5H2,1H3,(H,16,17).
What are the key properties of 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid?
2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid has a molecular weight of 239.22 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-4-[4-(methylamino)but-1-ynyl]benzoic acid is sourced from PubChem (CID 170464861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).