C11H11F2NO — CID 170464242
3,5-difluoro-4-[4-(methylamino)but-1-ynyl]phenol (PubChem CID 170464242) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 3,5-difluoro-4-[4-(methylamino)but-1-ynyl]phenol.
| Compound Name | 3,5-difluoro-4-[4-(methylamino)but-1-ynyl]phenol |
|---|---|
| PubChem CID | 170464242 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3,5-difluoro-4-[4-(methylamino)but-1-ynyl]phenol |
| SMILES | CNCCC#Cc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C11H11F2NO/c1-14-5-3-2-4-9-10(12)6-8(15)7-11(9)13/h6-7,14-15H,3,5H2,1H3 |
| InChIKey | LLFAAHSRFVXDBX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|