C11H13NO2 — CID 170463882
4-[4-(methylamino)but-1-ynyl]benzene-1,3-diol (PubChem CID 170463882) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-[4-(methylamino)but-1-ynyl]benzene-1,3-diol.
| Compound Name | 4-[4-(methylamino)but-1-ynyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 170463882 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-[4-(methylamino)but-1-ynyl]benzene-1,3-diol |
| SMILES | CNCCC#Cc1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO2/c1-12-7-3-2-4-9-5-6-10(13)8-11(9)14/h5-6,8,12-14H,3,7H2,1H3 |
| InChIKey | GYKODGHEVPOKQO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|