C9H6F2O2 — CID 163323399
3,5-difluoro-4-(3-hydroxyprop-1-ynyl)phenol (PubChem CID 163323399) has the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-hydroxyprop-1-ynyl)phenol.
| Compound Name | 3,5-difluoro-4-(3-hydroxyprop-1-ynyl)phenol |
|---|---|
| PubChem CID | 163323399 |
| Molecular Formula | C9H6F2O2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 3,5-difluoro-4-(3-hydroxyprop-1-ynyl)phenol |
| SMILES | OCC#Cc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C9H6F2O2/c10-8-4-6(13)5-9(11)7(8)2-1-3-12/h4-5,12-13H,3H2 |
| InChIKey | PRKWBESZKWQFMR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|