C12H13FO — CID 106882135
4-(2-fluoro-4,6-dimethylphenyl)but-3-yn-1-ol (PubChem CID 106882135) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 4-(2-fluoro-4,6-dimethylphenyl)but-3-yn-1-ol.
| Compound Name | 4-(2-fluoro-4,6-dimethylphenyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 106882135 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-(2-fluoro-4,6-dimethylphenyl)but-3-yn-1-ol |
| SMILES | Cc1cc(C)c(C#CCCO)c(F)c1 |
| InChI | InChI=1S/C12H13FO/c1-9-7-10(2)11(12(13)8-9)5-3-4-6-14/h7-8,14H,4,6H2,1-2H3 |
| InChIKey | BKNISPYCKHSRPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|