C12H14O2 — CID 130712503
4-[3-(hydroxymethyl)-4-methylphenyl]but-3-yn-1-ol (PubChem CID 130712503) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-4-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-(hydroxymethyl)-4-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 130712503 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-[3-(hydroxymethyl)-4-methylphenyl]but-3-yn-1-ol |
| SMILES | Cc1ccc(C#CCCO)cc1CO |
| InChI | InChI=1S/C12H14O2/c1-10-5-6-11(4-2-3-7-13)8-12(10)9-14/h5-6,8,13-14H,3,7,9H2,1H3 |
| InChIKey | HJRCRTCXZYVEBO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|