C19H20OS — CID 62769472
4-[4-[(2-methylphenyl)methylsulfanylmethyl]phenyl]but-3-yn-1-ol (PubChem CID 62769472) has the molecular formula C19H20OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-[4-[(2-methylphenyl)methylsulfanylmethyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-[(2-methylphenyl)methylsulfanylmethyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 62769472 |
| Molecular Formula | C19H20OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-[4-[(2-methylphenyl)methylsulfanylmethyl]phenyl]but-3-yn-1-ol |
| SMILES | Cc1ccccc1CSCc1ccc(C#CCCO)cc1 |
| InChI | InChI=1S/C19H20OS/c1-16-6-2-3-8-19(16)15-21-14-18-11-9-17(10-12-18)7-4-5-13-20/h2-3,6,8-12,20H,5,13-15H2,1H3 |
| InChIKey | VYAKATDMYZZSSK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|