C13H16O4 — CID 54923371
4-(2,4,6-trimethoxyphenyl)but-3-yn-1-ol (PubChem CID 54923371) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(2,4,6-trimethoxyphenyl)but-3-yn-1-ol.
| Compound Name | 4-(2,4,6-trimethoxyphenyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 54923371 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(2,4,6-trimethoxyphenyl)but-3-yn-1-ol |
| SMILES | COc1cc(OC)c(C#CCCO)c(OC)c1 |
| InChI | InChI=1S/C13H16O4/c1-15-10-8-12(16-2)11(6-4-5-7-14)13(9-10)17-3/h8-9,14H,5,7H2,1-3H3 |
| InChIKey | ARWHIIZREPQGEW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|