C13H15ClO — CID 170468047
2-(4-chlorobut-1-ynyl)-5-methoxy-1,3-dimethylbenzene (PubChem CID 170468047) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-5-methoxy-1,3-dimethylbenzene.
| Compound Name | 2-(4-chlorobut-1-ynyl)-5-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 170468047 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-5-methoxy-1,3-dimethylbenzene |
| SMILES | COc1cc(C)c(C#CCCCl)c(C)c1 |
| InChI | InChI=1S/C13H15ClO/c1-10-8-12(15-3)9-11(2)13(10)6-4-5-7-14/h8-9H,5,7H2,1-3H3 |
| InChIKey | ASNSLSGRKCRWBF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|