C14H18O4 — CID 15185412
2-methyl-4-(2,4,6-trimethoxyphenyl)but-3-yn-2-ol (PubChem CID 15185412) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-methyl-4-(2,4,6-trimethoxyphenyl)but-3-yn-2-ol.
| Compound Name | 2-methyl-4-(2,4,6-trimethoxyphenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 15185412 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-methyl-4-(2,4,6-trimethoxyphenyl)but-3-yn-2-ol |
| SMILES | COc1cc(OC)c(C#CC(C)(C)O)c(OC)c1 |
| InChI | InChI=1S/C14H18O4/c1-14(2,15)7-6-11-12(17-4)8-10(16-3)9-13(11)18-5/h8-9,15H,1-5H3 |
| InChIKey | ZTONVWWAVMXIOO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|