C14H18O2 — CID 160733436
1-(3,3-dimethylbut-1-ynyl)-2,4-dimethoxybenzene (PubChem CID 160733436) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-ynyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(3,3-dimethylbut-1-ynyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 160733436 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(3,3-dimethylbut-1-ynyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(C#CC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H18O2/c1-14(2,3)9-8-11-6-7-12(15-4)10-13(11)16-5/h6-7,10H,1-5H3 |
| InChIKey | IDRHXBNBBQMGEY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|