C15H20O4 — CID 65323848
4-[4-methoxy-2-(2-methoxyethoxymethyl)phenyl]but-3-yn-1-ol (PubChem CID 65323848) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-[4-methoxy-2-(2-methoxyethoxymethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-methoxy-2-(2-methoxyethoxymethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 65323848 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-[4-methoxy-2-(2-methoxyethoxymethyl)phenyl]but-3-yn-1-ol |
| SMILES | COCCOCc1cc(OC)ccc1C#CCCO |
| InChI | InChI=1S/C15H20O4/c1-17-9-10-19-12-14-11-15(18-2)7-6-13(14)5-3-4-8-16/h6-7,11,16H,4,8-10,12H2,1-2H3 |
| InChIKey | FGGRBKVNGLDBRE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|