C17H18O4 — CID 65323507
4-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]but-3-yn-1-ol (PubChem CID 65323507) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 65323507 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]but-3-yn-1-ol |
| SMILES | COc1ccc(C#CCCO)c(COCc2ccco2)c1 |
| InChI | InChI=1S/C17H18O4/c1-19-16-8-7-14(5-2-3-9-18)15(11-16)12-20-13-17-6-4-10-21-17/h4,6-8,10-11,18H,3,9,12-13H2,1H3 |
| InChIKey | GLCVFLMSJVGNLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|