C16H17NO3 — CID 65325233
3-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]prop-2-yn-1-amine (PubChem CID 65325233) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 65325233 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[2-(furan-2-ylmethoxymethyl)-4-methoxyphenyl]prop-2-yn-1-amine |
| SMILES | COc1ccc(C#CCN)c(COCc2ccco2)c1 |
| InChI | InChI=1S/C16H17NO3/c1-18-15-7-6-13(4-2-8-17)14(10-15)11-19-12-16-5-3-9-20-16/h3,5-7,9-10H,8,11-12,17H2,1H3 |
| InChIKey | ZWGRABNTASFOSB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|